C25H28Cl2N2O3S — CID 5301035
5-(1-adamantylmethylsulfamoyl)-N-benzyl-2,4-dichlorobenzamide (PubChem CID 5301035) has the molecular formula C25H28Cl2N2O3S and a molecular weight of 507.48 g/mol. Its IUPAC name is 5-(1-adamantylmethylsulfamoyl)-N-benzyl-2,4-dichlorobenzamide.
| Compound Name | 5-(1-adamantylmethylsulfamoyl)-N-benzyl-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 5301035 |
| Molecular Formula | C25H28Cl2N2O3S |
| Molecular Weight | 507.48 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 5-(1-adamantylmethylsulfamoyl)-N-benzyl-2,4-dichlorobenzamide |
| SMILES | O=C(NCc1ccccc1)c1cc(S(=O)(=O)NCC23CC4CC(CC(C4)C2)C3)c(Cl)cc1Cl |
| InChI | InChI=1S/C25H28Cl2N2O3S/c26-21-10-22(27)23(9-20(21)24(30)28-14-16-4-2-1-3-5-16)33(31,32)29-15-25-11-17-6-18(12-25)8-19(7-17)13-25/h1-5,9-10,17-19,29H,6-8,11-15H2,(H,28,30) |
| InChIKey | GAYFSMOKSTZWSM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |