C21H28Cl2N2O3S — CID 4919001
N-[2-(1-adamantyl)ethyl]-2,4-dichloro-5-(dimethylsulfamoyl)benzamide (PubChem CID 4919001) has the molecular formula C21H28Cl2N2O3S and a molecular weight of 459.44 g/mol. Its IUPAC name is N-[2-(1-adamantyl)ethyl]-2,4-dichloro-5-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[2-(1-adamantyl)ethyl]-2,4-dichloro-5-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 4919001 |
| Molecular Formula | C21H28Cl2N2O3S |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N-[2-(1-adamantyl)ethyl]-2,4-dichloro-5-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)NCCC23CC4CC(CC(C4)C2)C3)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H28Cl2N2O3S/c1-25(2)29(27,28)19-8-16(17(22)9-18(19)23)20(26)24-4-3-21-10-13-5-14(11-21)7-15(6-13)12-21/h8-9,13-15H,3-7,10-12H2,1-2H3,(H,24,26) |
| InChIKey | NVBRGMBRQHAIOE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |