C9H10Cl2N2O3S — CID 977911
2,4-dichloro-5-(dimethylsulfamoyl)benzamide (PubChem CID 977911) has the molecular formula C9H10Cl2N2O3S and a molecular weight of 297.16 g/mol. Its IUPAC name is 2,4-dichloro-5-(dimethylsulfamoyl)benzamide.
| Compound Name | 2,4-dichloro-5-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 977911 |
| Molecular Formula | C9H10Cl2N2O3S |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 2,4-dichloro-5-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(N)=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl2N2O3S/c1-13(2)17(15,16)8-3-5(9(12)14)6(10)4-7(8)11/h3-4H,1-2H3,(H2,12,14) |
| InChIKey | SCKOZKXFIVGKFB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |