C13H16Cl2N2O5S2 — CID 7358811
2,4-dichloro-5-(dimethylsulfamoyl)-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 7358811) has the molecular formula C13H16Cl2N2O5S2 and a molecular weight of 415.32 g/mol. Its IUPAC name is 2,4-dichloro-5-(dimethylsulfamoyl)-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | 2,4-dichloro-5-(dimethylsulfamoyl)-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 7358811 |
| Molecular Formula | C13H16Cl2N2O5S2 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 2,4-dichloro-5-(dimethylsulfamoyl)-N-[(3R)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)N[C@@H]2CCS(=O)(=O)C2)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O5S2/c1-17(2)24(21,22)12-5-9(10(14)6-11(12)15)13(18)16-8-3-4-23(19,20)7-8/h5-6,8H,3-4,7H2,1-2H3,(H,16,18)/t8-/m1/s1 |
| InChIKey | HUIBLIASTOWAMI-MRVPVSSYSA-N |
| XLogP | 1.16 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |