C23H28Cl2N2O3S — CID 5306242
2,4-dichloro-N-(2-cyclohexyl-2-phenylethyl)-5-(dimethylsulfamoyl)benzamide (PubChem CID 5306242) has the molecular formula C23H28Cl2N2O3S and a molecular weight of 483.46 g/mol. Its IUPAC name is 2,4-dichloro-N-(2-cyclohexyl-2-phenylethyl)-5-(dimethylsulfamoyl)benzamide.
| Compound Name | 2,4-dichloro-N-(2-cyclohexyl-2-phenylethyl)-5-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 5306242 |
| Molecular Formula | C23H28Cl2N2O3S |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 2,4-dichloro-N-(2-cyclohexyl-2-phenylethyl)-5-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)NCC(c2ccccc2)C2CCCCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C23H28Cl2N2O3S/c1-27(2)31(29,30)22-13-18(20(24)14-21(22)25)23(28)26-15-19(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3,5-6,9-10,13-14,17,19H,4,7-8,11-12,15H2,1-2H3,(H,26,28) |
| InChIKey | LQWOGZBFRJRFCQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |