C21H25Cl2N3O4S — CID 16763255
2,4-dichloro-5-(dimethylsulfamoyl)-N-(2-morpholin-4-yl-2-phenylethyl)benzamide (PubChem CID 16763255) has the molecular formula C21H25Cl2N3O4S and a molecular weight of 486.42 g/mol. Its IUPAC name is 2,4-dichloro-5-(dimethylsulfamoyl)-N-(2-morpholin-4-yl-2-phenylethyl)benzamide.
| Compound Name | 2,4-dichloro-5-(dimethylsulfamoyl)-N-(2-morpholin-4-yl-2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 16763255 |
| Molecular Formula | C21H25Cl2N3O4S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 2,4-dichloro-5-(dimethylsulfamoyl)-N-(2-morpholin-4-yl-2-phenylethyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)NCC(c2ccccc2)N2CCOCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H25Cl2N3O4S/c1-25(2)31(28,29)20-12-16(17(22)13-18(20)23)21(27)24-14-19(15-6-4-3-5-7-15)26-8-10-30-11-9-26/h3-7,12-13,19H,8-11,14H2,1-2H3,(H,24,27) |
| InChIKey | DXDRVZBLILFCFD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |