C15H15Cl2N3O3S — CID 1259983
2,4-dichloro-5-(dimethylsulfamoyl)-N-(pyridin-4-ylmethyl)benzamide (PubChem CID 1259983) has the molecular formula C15H15Cl2N3O3S and a molecular weight of 388.28 g/mol. Its IUPAC name is 2,4-dichloro-5-(dimethylsulfamoyl)-N-(pyridin-4-ylmethyl)benzamide.
| Compound Name | 2,4-dichloro-5-(dimethylsulfamoyl)-N-(pyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 1259983 |
| Molecular Formula | C15H15Cl2N3O3S |
| Molecular Weight | 388.28 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 2,4-dichloro-5-(dimethylsulfamoyl)-N-(pyridin-4-ylmethyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)NCc2ccncc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H15Cl2N3O3S/c1-20(2)24(22,23)14-7-11(12(16)8-13(14)17)15(21)19-9-10-3-5-18-6-4-10/h3-8H,9H2,1-2H3,(H,19,21) |
| InChIKey | INJQGVPVMRLLAQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |