C20H25ClN2O4S — CID 55894371
2-chloro-5-(dimethylsulfamoyl)-N-[[4-(2-methylpropoxy)phenyl]methyl]benzamide (PubChem CID 55894371) has the molecular formula C20H25ClN2O4S and a molecular weight of 424.95 g/mol. Its IUPAC name is 2-chloro-5-(dimethylsulfamoyl)-N-[[4-(2-methylpropoxy)phenyl]methyl]benzamide.
| Compound Name | 2-chloro-5-(dimethylsulfamoyl)-N-[[4-(2-methylpropoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55894371 |
| Molecular Formula | C20H25ClN2O4S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-chloro-5-(dimethylsulfamoyl)-N-[[4-(2-methylpropoxy)phenyl]methyl]benzamide |
| SMILES | CC(C)COc1ccc(CNC(=O)c2cc(S(=O)(=O)N(C)C)ccc2Cl)cc1 |
| InChI | InChI=1S/C20H25ClN2O4S/c1-14(2)13-27-16-7-5-15(6-8-16)12-22-20(24)18-11-17(9-10-19(18)21)28(25,26)23(3)4/h5-11,14H,12-13H2,1-4H3,(H,22,24) |
| InChIKey | BIVRRNVQYDPGGD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |