C19H24ClN3O5S2 — CID 30839055
2-chloro-5-(dimethylsulfamoyl)-N-[[3-(propan-2-ylsulfamoyl)phenyl]methyl]benzamide (PubChem CID 30839055) has the molecular formula C19H24ClN3O5S2 and a molecular weight of 474.00 g/mol. Its IUPAC name is 2-chloro-5-(dimethylsulfamoyl)-N-[[3-(propan-2-ylsulfamoyl)phenyl]methyl]benzamide.
| Compound Name | 2-chloro-5-(dimethylsulfamoyl)-N-[[3-(propan-2-ylsulfamoyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 30839055 |
| Molecular Formula | C19H24ClN3O5S2 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 2-chloro-5-(dimethylsulfamoyl)-N-[[3-(propan-2-ylsulfamoyl)phenyl]methyl]benzamide |
| SMILES | CC(C)NS(=O)(=O)c1cccc(CNC(=O)c2cc(S(=O)(=O)N(C)C)ccc2Cl)c1 |
| InChI | InChI=1S/C19H24ClN3O5S2/c1-13(2)22-29(25,26)15-7-5-6-14(10-15)12-21-19(24)17-11-16(8-9-18(17)20)30(27,28)23(3)4/h5-11,13,22H,12H2,1-4H3,(H,21,24) |
| InChIKey | HCBZJWDNMRPYFF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |