C22H29ClN2O4S — CID 46387544
N-[(4-butoxyphenyl)methyl]-2-chloro-5-(diethylsulfamoyl)benzamide (PubChem CID 46387544) has the molecular formula C22H29ClN2O4S and a molecular weight of 453.00 g/mol. Its IUPAC name is N-[(4-butoxyphenyl)methyl]-2-chloro-5-(diethylsulfamoyl)benzamide.
| Compound Name | N-[(4-butoxyphenyl)methyl]-2-chloro-5-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 46387544 |
| Molecular Formula | C22H29ClN2O4S |
| Molecular Weight | 453.00 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-[(4-butoxyphenyl)methyl]-2-chloro-5-(diethylsulfamoyl)benzamide |
| SMILES | CCCCOc1ccc(CNC(=O)c2cc(S(=O)(=O)N(CC)CC)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H29ClN2O4S/c1-4-7-14-29-18-10-8-17(9-11-18)16-24-22(26)20-15-19(12-13-21(20)23)30(27,28)25(5-2)6-3/h8-13,15H,4-7,14,16H2,1-3H3,(H,24,26) |
| InChIKey | WAYZDHCQSUUTES-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.00 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|