C17H19ClN2O3S — CID 41337965
2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide (PubChem CID 41337965) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide.
| Compound Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
|---|---|
| PubChem CID | 41337965 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[(3S)-1,1-dioxothiolan-3-yl]benzamide |
| SMILES | Cc1ccc(C)n1-c1ccc(Cl)c(C(=O)N[C@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C17H19ClN2O3S/c1-11-3-4-12(2)20(11)14-5-6-16(18)15(9-14)17(21)19-13-7-8-24(22,23)10-13/h3-6,9,13H,7-8,10H2,1-2H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | NHSVWBFNRKJNHW-ZDUSSCGKSA-N |
| XLogP | 2.66 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|