C16H20ClFN2O3S — CID 129357673
2-chloro-N-[1-[(3S)-1,1-dioxothiolan-3-yl]piperidin-4-yl]-5-fluorobenzamide (PubChem CID 129357673) has the molecular formula C16H20ClFN2O3S and a molecular weight of 374.87 g/mol. Its IUPAC name is 2-chloro-N-[1-[(3S)-1,1-dioxothiolan-3-yl]piperidin-4-yl]-5-fluorobenzamide.
| Compound Name | 2-chloro-N-[1-[(3S)-1,1-dioxothiolan-3-yl]piperidin-4-yl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 129357673 |
| Molecular Formula | C16H20ClFN2O3S |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 2-chloro-N-[1-[(3S)-1,1-dioxothiolan-3-yl]piperidin-4-yl]-5-fluorobenzamide |
| SMILES | O=C(NC1CCN([C@H]2CCS(=O)(=O)C2)CC1)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C16H20ClFN2O3S/c17-15-2-1-11(18)9-14(15)16(21)19-12-3-6-20(7-4-12)13-5-8-24(22,23)10-13/h1-2,9,12-13H,3-8,10H2,(H,19,21)/t13-/m0/s1 |
| InChIKey | UKNNHDVYKWBFFF-ZDUSSCGKSA-N |
| XLogP | 1.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |