C22H27ClFN5O — CID 50845661
N-[1-[6-(azepan-1-yl)pyridazin-3-yl]piperidin-4-yl]-2-chloro-5-fluorobenzamide (PubChem CID 50845661) has the molecular formula C22H27ClFN5O and a molecular weight of 431.94 g/mol. Its IUPAC name is N-[1-[6-(azepan-1-yl)pyridazin-3-yl]piperidin-4-yl]-2-chloro-5-fluorobenzamide.
| Compound Name | N-[1-[6-(azepan-1-yl)pyridazin-3-yl]piperidin-4-yl]-2-chloro-5-fluorobenzamide |
|---|---|
| PubChem CID | 50845661 |
| Molecular Formula | C22H27ClFN5O |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[1-[6-(azepan-1-yl)pyridazin-3-yl]piperidin-4-yl]-2-chloro-5-fluorobenzamide |
| SMILES | O=C(NC1CCN(c2ccc(N3CCCCCC3)nn2)CC1)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C22H27ClFN5O/c23-19-6-5-16(24)15-18(19)22(30)25-17-9-13-29(14-10-17)21-8-7-20(26-27-21)28-11-3-1-2-4-12-28/h5-8,15,17H,1-4,9-14H2,(H,25,30) |
| InChIKey | HBAMWTLMTRHXNF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |