C21H27FN6O — CID 113043162
1-cyclohexyl-3-[6-[4-(4-fluorophenyl)piperazin-1-yl]pyridazin-3-yl]urea (PubChem CID 113043162) has the molecular formula C21H27FN6O and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-cyclohexyl-3-[6-[4-(4-fluorophenyl)piperazin-1-yl]pyridazin-3-yl]urea.
| Compound Name | 1-cyclohexyl-3-[6-[4-(4-fluorophenyl)piperazin-1-yl]pyridazin-3-yl]urea |
|---|---|
| PubChem CID | 113043162 |
| Molecular Formula | C21H27FN6O |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-cyclohexyl-3-[6-[4-(4-fluorophenyl)piperazin-1-yl]pyridazin-3-yl]urea |
| SMILES | O=C(Nc1ccc(N2CCN(c3ccc(F)cc3)CC2)nn1)NC1CCCCC1 |
| InChI | InChI=1S/C21H27FN6O/c22-16-6-8-18(9-7-16)27-12-14-28(15-13-27)20-11-10-19(25-26-20)24-21(29)23-17-4-2-1-3-5-17/h6-11,17H,1-5,12-15H2,(H2,23,24,25,29) |
| InChIKey | YHIKJJPYYBQANX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |