C23H27F3N6O2 — CID 11340510
1-cyclohexyl-3-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl]urea (PubChem CID 11340510) has the molecular formula C23H27F3N6O2 and a molecular weight of 476.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl]urea.
| Compound Name | 1-cyclohexyl-3-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl]urea |
|---|---|
| PubChem CID | 11340510 |
| Molecular Formula | C23H27F3N6O2 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 1-cyclohexyl-3-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl]urea |
| SMILES | O=C(Nc1ccc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)nn1)NC1CCCCC1 |
| InChI | InChI=1S/C23H27F3N6O2/c24-23(25,26)18-9-5-4-8-17(18)21(33)32-14-12-31(13-15-32)20-11-10-19(29-30-20)28-22(34)27-16-6-2-1-3-7-16/h4-5,8-11,16H,1-3,6-7,12-15H2,(H2,27,28,29,34) |
| InChIKey | PKZCAEWGUUMUON-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |