C25H25F3N6O2 — CID 69267018
1-(1-phenylethyl)-3-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl]urea (PubChem CID 69267018) has the molecular formula C25H25F3N6O2 and a molecular weight of 498.51 g/mol. Its IUPAC name is 1-(1-phenylethyl)-3-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl]urea.
| Compound Name | 1-(1-phenylethyl)-3-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl]urea |
|---|---|
| PubChem CID | 69267018 |
| Molecular Formula | C25H25F3N6O2 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 1-(1-phenylethyl)-3-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl]urea |
| SMILES | CC(NC(=O)Nc1ccc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)nn1)c1ccccc1 |
| InChI | InChI=1S/C25H25F3N6O2/c1-17(18-7-3-2-4-8-18)29-24(36)30-21-11-12-22(32-31-21)33-13-15-34(16-14-33)23(35)19-9-5-6-10-20(19)25(26,27)28/h2-12,17H,13-16H2,1H3,(H2,29,30,31,36) |
| InChIKey | OPLUXDIYIDDQRR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |