C21H24F3N5O3 — CID 66849865
butyl N-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl]carbamate (PubChem CID 66849865) has the molecular formula C21H24F3N5O3 and a molecular weight of 451.45 g/mol. Its IUPAC name is butyl N-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl]carbamate.
| Compound Name | butyl N-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl]carbamate |
|---|---|
| PubChem CID | 66849865 |
| Molecular Formula | C21H24F3N5O3 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | butyl N-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1ccc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C21H24F3N5O3/c1-2-3-14-32-20(31)25-17-8-9-18(27-26-17)28-10-12-29(13-11-28)19(30)15-6-4-5-7-16(15)21(22,23)24/h4-9H,2-3,10-14H2,1H3,(H,25,26,31) |
| InChIKey | VFLFJFVCZQFPQK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|