C24H30F3N5O2 — CID 67012400
N-heptyl-6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide (PubChem CID 67012400) has the molecular formula C24H30F3N5O2 and a molecular weight of 477.53 g/mol. Its IUPAC name is N-heptyl-6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide.
| Compound Name | N-heptyl-6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 67012400 |
| Molecular Formula | C24H30F3N5O2 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | N-heptyl-6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide |
| SMILES | CCCCCCCNC(=O)c1ccc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C24H30F3N5O2/c1-2-3-4-5-8-13-28-22(33)20-11-12-21(30-29-20)31-14-16-32(17-15-31)23(34)18-9-6-7-10-19(18)24(25,26)27/h6-7,9-12H,2-5,8,13-17H2,1H3,(H,28,33) |
| InChIKey | KHZYPVIQTUBFJE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|