C17H16F3N5O3 — CID 141143829
N-hydroxy-6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide (PubChem CID 141143829) has the molecular formula C17H16F3N5O3 and a molecular weight of 395.34 g/mol. Its IUPAC name is N-hydroxy-6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide.
| Compound Name | N-hydroxy-6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 141143829 |
| Molecular Formula | C17H16F3N5O3 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-hydroxy-6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazine-3-carboxamide |
| SMILES | O=C(NO)c1ccc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C17H16F3N5O3/c18-17(19,20)12-4-2-1-3-11(12)16(27)25-9-7-24(8-10-25)14-6-5-13(21-22-14)15(26)23-28/h1-6,28H,7-10H2,(H,23,26) |
| InChIKey | HOEJPHODWJNBPA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|