C23H28F3N5O2 — CID 11328730
1-pentyl-3-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-3-pyridinyl]urea (PubChem CID 11328730) has the molecular formula C23H28F3N5O2 and a molecular weight of 463.50 g/mol. Its IUPAC name is 1-pentyl-3-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-3-pyridinyl]urea.
| Compound Name | 1-pentyl-3-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-3-pyridinyl]urea |
|---|---|
| PubChem CID | 11328730 |
| Molecular Formula | C23H28F3N5O2 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 1-pentyl-3-[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-3-pyridinyl]urea |
| SMILES | CCCCCNC(=O)Nc1ccc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)nc1 |
| InChI | InChI=1S/C23H28F3N5O2/c1-2-3-6-11-27-22(33)29-17-9-10-20(28-16-17)30-12-14-31(15-13-30)21(32)18-7-4-5-8-19(18)23(24,25)26/h4-5,7-10,16H,2-3,6,11-15H2,1H3,(H2,27,29,33) |
| InChIKey | UTUFVPXFZZZFGN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|