C23H27F3N4O2 — CID 68737275
N-pentyl-6-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 68737275) has the molecular formula C23H27F3N4O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is N-pentyl-6-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-pentyl-6-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68737275 |
| Molecular Formula | C23H27F3N4O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-pentyl-6-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | CCCCCNC(=O)c1ccc(N2CCN(C(=O)c3ccc(C(F)(F)F)cc3)CC2)nc1 |
| InChI | InChI=1S/C23H27F3N4O2/c1-2-3-4-11-27-21(31)18-7-10-20(28-16-18)29-12-14-30(15-13-29)22(32)17-5-8-19(9-6-17)23(24,25)26/h5-10,16H,2-4,11-15H2,1H3,(H,27,31) |
| InChIKey | TZUUBMCRDMGPHK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|