C27H27F3N4O2 — CID 68736593
N-(3-phenylpropyl)-6-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 68736593) has the molecular formula C27H27F3N4O2 and a molecular weight of 496.53 g/mol. Its IUPAC name is N-(3-phenylpropyl)-6-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(3-phenylpropyl)-6-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68736593 |
| Molecular Formula | C27H27F3N4O2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N-(3-phenylpropyl)-6-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1ccc(N2CCN(C(=O)c3cccc(C(F)(F)F)c3)CC2)nc1 |
| InChI | InChI=1S/C27H27F3N4O2/c28-27(29,30)23-10-4-9-21(18-23)26(36)34-16-14-33(15-17-34)24-12-11-22(19-32-24)25(35)31-13-5-8-20-6-2-1-3-7-20/h1-4,6-7,9-12,18-19H,5,8,13-17H2,(H,31,35) |
| InChIKey | QQSSEFBJGOEBHU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|