C22H25F3N4O2S — CID 68739731
N-(2-ethylsulfanylethyl)-6-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 68739731) has the molecular formula C22H25F3N4O2S and a molecular weight of 466.53 g/mol. Its IUPAC name is N-(2-ethylsulfanylethyl)-6-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | N-(2-ethylsulfanylethyl)-6-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68739731 |
| Molecular Formula | C22H25F3N4O2S |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-(2-ethylsulfanylethyl)-6-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | CCSCCNC(=O)c1ccc(N2CCN(C(=O)c3cccc(C(F)(F)F)c3)CC2)nc1 |
| InChI | InChI=1S/C22H25F3N4O2S/c1-2-32-13-8-26-20(30)17-6-7-19(27-15-17)28-9-11-29(12-10-28)21(31)16-4-3-5-18(14-16)22(23,24)25/h3-7,14-15H,2,8-13H2,1H3,(H,26,30) |
| InChIKey | JWSAGICOTTXEAT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|