C19H30N4O2S — CID 11280398
N-(2-ethylsulfanylethyl)-6-(4-pentanoylpiperazin-1-yl)pyridine-3-carboxamide (PubChem CID 11280398) has the molecular formula C19H30N4O2S and a molecular weight of 378.54 g/mol. Its IUPAC name is N-(2-ethylsulfanylethyl)-6-(4-pentanoylpiperazin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-ethylsulfanylethyl)-6-(4-pentanoylpiperazin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11280398 |
| Molecular Formula | C19H30N4O2S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-(2-ethylsulfanylethyl)-6-(4-pentanoylpiperazin-1-yl)pyridine-3-carboxamide |
| SMILES | CCCCC(=O)N1CCN(c2ccc(C(=O)NCCSCC)cn2)CC1 |
| InChI | InChI=1S/C19H30N4O2S/c1-3-5-6-18(24)23-12-10-22(11-13-23)17-8-7-16(15-21-17)19(25)20-9-14-26-4-2/h7-8,15H,3-6,9-14H2,1-2H3,(H,20,25) |
| InChIKey | LLXNHHNMEZTJAK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|