C28H30ClFN4O2 — CID 68740615
6-[4-[2-(2-chloro-6-fluorophenyl)acetyl]piperazin-1-yl]-N-(4-phenylbutyl)pyridine-3-carboxamide (PubChem CID 68740615) has the molecular formula C28H30ClFN4O2 and a molecular weight of 509.03 g/mol. Its IUPAC name is 6-[4-[2-(2-chloro-6-fluorophenyl)acetyl]piperazin-1-yl]-N-(4-phenylbutyl)pyridine-3-carboxamide.
| Compound Name | 6-[4-[2-(2-chloro-6-fluorophenyl)acetyl]piperazin-1-yl]-N-(4-phenylbutyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68740615 |
| Molecular Formula | C28H30ClFN4O2 |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | 6-[4-[2-(2-chloro-6-fluorophenyl)acetyl]piperazin-1-yl]-N-(4-phenylbutyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCCCc1ccccc1)c1ccc(N2CCN(C(=O)Cc3c(F)cccc3Cl)CC2)nc1 |
| InChI | InChI=1S/C28H30ClFN4O2/c29-24-10-6-11-25(30)23(24)19-27(35)34-17-15-33(16-18-34)26-13-12-22(20-32-26)28(36)31-14-5-4-9-21-7-2-1-3-8-21/h1-3,6-8,10-13,20H,4-5,9,14-19H2,(H,31,36) |
| InChIKey | AONSDTIWMVFXHE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|