C24H30ClFN4O3 — CID 68737118
6-[4-[2-(2-chloro-6-fluorophenyl)acetyl]piperazin-1-yl]-N-(3-propan-2-yloxypropyl)pyridine-3-carboxamide (PubChem CID 68737118) has the molecular formula C24H30ClFN4O3 and a molecular weight of 476.98 g/mol. Its IUPAC name is 6-[4-[2-(2-chloro-6-fluorophenyl)acetyl]piperazin-1-yl]-N-(3-propan-2-yloxypropyl)pyridine-3-carboxamide.
| Compound Name | 6-[4-[2-(2-chloro-6-fluorophenyl)acetyl]piperazin-1-yl]-N-(3-propan-2-yloxypropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68737118 |
| Molecular Formula | C24H30ClFN4O3 |
| Molecular Weight | 476.98 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 6-[4-[2-(2-chloro-6-fluorophenyl)acetyl]piperazin-1-yl]-N-(3-propan-2-yloxypropyl)pyridine-3-carboxamide |
| SMILES | CC(C)OCCCNC(=O)c1ccc(N2CCN(C(=O)Cc3c(F)cccc3Cl)CC2)nc1 |
| InChI | InChI=1S/C24H30ClFN4O3/c1-17(2)33-14-4-9-27-24(32)18-7-8-22(28-16-18)29-10-12-30(13-11-29)23(31)15-19-20(25)5-3-6-21(19)26/h3,5-8,16-17H,4,9-15H2,1-2H3,(H,27,32) |
| InChIKey | OKCKBKLRIVHRAZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.98 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|