C27H27F4N5O2 — CID 11295486
1-[3-(4-fluorophenyl)propyl]-3-[5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-2-pyridinyl]urea (PubChem CID 11295486) has the molecular formula C27H27F4N5O2 and a molecular weight of 529.54 g/mol. Its IUPAC name is 1-[3-(4-fluorophenyl)propyl]-3-[5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-2-pyridinyl]urea.
| Compound Name | 1-[3-(4-fluorophenyl)propyl]-3-[5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-2-pyridinyl]urea |
|---|---|
| PubChem CID | 11295486 |
| Molecular Formula | C27H27F4N5O2 |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 1-[3-(4-fluorophenyl)propyl]-3-[5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-2-pyridinyl]urea |
| SMILES | O=C(NCCCc1ccc(F)cc1)Nc1ccc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)cn1 |
| InChI | InChI=1S/C27H27F4N5O2/c28-20-9-7-19(8-10-20)4-3-13-32-26(38)34-24-12-11-21(18-33-24)35-14-16-36(17-15-35)25(37)22-5-1-2-6-23(22)27(29,30)31/h1-2,5-12,18H,3-4,13-17H2,(H2,32,33,34,38) |
| InChIKey | KAYXHBWBJGNTIR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|