C17H22BrNO2 — CID 106852949
N-[2-(1-adamantyl)ethyl]-2-bromofuran-3-carboxamide (PubChem CID 106852949) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is N-[2-(1-adamantyl)ethyl]-2-bromofuran-3-carboxamide.
| Compound Name | N-[2-(1-adamantyl)ethyl]-2-bromofuran-3-carboxamide |
|---|---|
| PubChem CID | 106852949 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-[2-(1-adamantyl)ethyl]-2-bromofuran-3-carboxamide |
| SMILES | O=C(NCCC12CC3CC(CC(C3)C1)C2)c1ccoc1Br |
| InChI | InChI=1S/C17H22BrNO2/c18-15-14(1-4-21-15)16(20)19-3-2-17-8-11-5-12(9-17)7-13(6-11)10-17/h1,4,11-13H,2-3,5-10H2,(H,19,20) |
| InChIKey | RTFIWZCVMHLRIL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |