C16H18Cl2N2O3S2 — CID 78785955
2,4-dichloro-5-(2-methylpropylsulfamoyl)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 78785955) has the molecular formula C16H18Cl2N2O3S2 and a molecular weight of 421.37 g/mol. Its IUPAC name is 2,4-dichloro-5-(2-methylpropylsulfamoyl)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 2,4-dichloro-5-(2-methylpropylsulfamoyl)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 78785955 |
| Molecular Formula | C16H18Cl2N2O3S2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | 2,4-dichloro-5-(2-methylpropylsulfamoyl)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | CC(C)CNS(=O)(=O)c1cc(C(=O)NCc2cccs2)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N2O3S2/c1-10(2)8-20-25(22,23)15-6-12(13(17)7-14(15)18)16(21)19-9-11-4-3-5-24-11/h3-7,10,20H,8-9H2,1-2H3,(H,19,21) |
| InChIKey | LMSDBWNQLVRQGP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |