C16H18ClN3O2S — CID 119342331
5-[(2-amino-2-methylpropanoyl)amino]-2-chloro-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 119342331) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is 5-[(2-amino-2-methylpropanoyl)amino]-2-chloro-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 5-[(2-amino-2-methylpropanoyl)amino]-2-chloro-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 119342331 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 5-[(2-amino-2-methylpropanoyl)amino]-2-chloro-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | CC(C)(N)C(=O)Nc1ccc(Cl)c(C(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C16H18ClN3O2S/c1-16(2,18)15(22)20-10-5-6-13(17)12(8-10)14(21)19-9-11-4-3-7-23-11/h3-8H,9,18H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | OCALPMKFUNCCAQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |