C18H22ClN3O2S — CID 119816424
5-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-chloro-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 119816424) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is 5-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-chloro-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 5-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-chloro-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 119816424 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 5-[[(2S)-2-amino-4-methylpentanoyl]amino]-2-chloro-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1ccc(Cl)c(C(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C18H22ClN3O2S/c1-11(2)8-16(20)18(24)22-12-5-6-15(19)14(9-12)17(23)21-10-13-4-3-7-25-13/h3-7,9,11,16H,8,10,20H2,1-2H3,(H,21,23)(H,22,24)/t16-/m0/s1 |
| InChIKey | CTULIAXOKDXTQM-INIZCTEOSA-N |
| XLogP | 3.64 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |