C10H7Cl2NOS2 — CID 110186920
4,5-dichloro-N-(thiophen-2-ylmethyl)thiophene-2-carboxamide (PubChem CID 110186920) has the molecular formula C10H7Cl2NOS2 and a molecular weight of 292.21 g/mol. Its IUPAC name is 4,5-dichloro-N-(thiophen-2-ylmethyl)thiophene-2-carboxamide.
| Compound Name | 4,5-dichloro-N-(thiophen-2-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 110186920 |
| Molecular Formula | C10H7Cl2NOS2 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 290.93 |
| IUPAC Name | 4,5-dichloro-N-(thiophen-2-ylmethyl)thiophene-2-carboxamide |
| SMILES | O=C(NCc1cccs1)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C10H7Cl2NOS2/c11-7-4-8(16-9(7)12)10(14)13-5-6-2-1-3-15-6/h1-4H,5H2,(H,13,14) |
| InChIKey | WAARUNCHKMQRSX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |