C15H18N2O3S3 — CID 6502784
5-methyl-4-pyrrolidin-1-ylsulfonyl-N-(thiophen-2-ylmethyl)thiophene-2-carboxamide (PubChem CID 6502784) has the molecular formula C15H18N2O3S3 and a molecular weight of 370.52 g/mol. Its IUPAC name is 5-methyl-4-pyrrolidin-1-ylsulfonyl-N-(thiophen-2-ylmethyl)thiophene-2-carboxamide.
| Compound Name | 5-methyl-4-pyrrolidin-1-ylsulfonyl-N-(thiophen-2-ylmethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6502784 |
| Molecular Formula | C15H18N2O3S3 |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 5-methyl-4-pyrrolidin-1-ylsulfonyl-N-(thiophen-2-ylmethyl)thiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)NCc2cccs2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C15H18N2O3S3/c1-11-14(23(19,20)17-6-2-3-7-17)9-13(22-11)15(18)16-10-12-5-4-8-21-12/h4-5,8-9H,2-3,6-7,10H2,1H3,(H,16,18) |
| InChIKey | RBSQPWPOUSKUDK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |