C13H16N2O3S3 — CID 6503006
N-ethyl-5-methyl-4-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxamide (PubChem CID 6503006) has the molecular formula C13H16N2O3S3 and a molecular weight of 344.48 g/mol. Its IUPAC name is N-ethyl-5-methyl-4-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxamide.
| Compound Name | N-ethyl-5-methyl-4-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6503006 |
| Molecular Formula | C13H16N2O3S3 |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | N-ethyl-5-methyl-4-(thiophen-2-ylmethylsulfamoyl)thiophene-2-carboxamide |
| SMILES | CCNC(=O)c1cc(S(=O)(=O)NCc2cccs2)c(C)s1 |
| InChI | InChI=1S/C13H16N2O3S3/c1-3-14-13(16)11-7-12(9(2)20-11)21(17,18)15-8-10-5-4-6-19-10/h4-7,15H,3,8H2,1-2H3,(H,14,16) |
| InChIKey | LQDSIZQONUDUPO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |