C19H19N3O4S2 — CID 5008714
2-oxo-6-pyrrolidin-1-ylsulfonyl-N-(thiophen-2-ylmethyl)-1H-quinoline-4-carboxamide (PubChem CID 5008714) has the molecular formula C19H19N3O4S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-oxo-6-pyrrolidin-1-ylsulfonyl-N-(thiophen-2-ylmethyl)-1H-quinoline-4-carboxamide.
| Compound Name | 2-oxo-6-pyrrolidin-1-ylsulfonyl-N-(thiophen-2-ylmethyl)-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5008714 |
| Molecular Formula | C19H19N3O4S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 2-oxo-6-pyrrolidin-1-ylsulfonyl-N-(thiophen-2-ylmethyl)-1H-quinoline-4-carboxamide |
| SMILES | O=C(NCc1cccs1)c1cc(=O)[nH]c2ccc(S(=O)(=O)N3CCCC3)cc12 |
| InChI | InChI=1S/C19H19N3O4S2/c23-18-11-16(19(24)20-12-13-4-3-9-27-13)15-10-14(5-6-17(15)21-18)28(25,26)22-7-1-2-8-22/h3-6,9-11H,1-2,7-8,12H2,(H,20,24)(H,21,23) |
| InChIKey | YMEBHTSLWGLBQU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |