C25H29N3O4S — CID 22427070
6-(azepan-1-ylsulfonyl)-N-[2-(4-methylphenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 22427070) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is 6-(azepan-1-ylsulfonyl)-N-[2-(4-methylphenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | 6-(azepan-1-ylsulfonyl)-N-[2-(4-methylphenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 22427070 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 6-(azepan-1-ylsulfonyl)-N-[2-(4-methylphenyl)ethyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | Cc1ccc(CCNC(=O)c2cc(=O)[nH]c3ccc(S(=O)(=O)N4CCCCCC4)cc23)cc1 |
| InChI | InChI=1S/C25H29N3O4S/c1-18-6-8-19(9-7-18)12-13-26-25(30)22-17-24(29)27-23-11-10-20(16-21(22)23)33(31,32)28-14-4-2-3-5-15-28/h6-11,16-17H,2-5,12-15H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | NODBRAKFZRKZNG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |