C27H34N4O4S — CID 20967939
N-[3-(N-butylanilino)propyl]-2-oxo-6-pyrrolidin-1-ylsulfonyl-1H-quinoline-4-carboxamide (PubChem CID 20967939) has the molecular formula C27H34N4O4S and a molecular weight of 510.66 g/mol. Its IUPAC name is N-[3-(N-butylanilino)propyl]-2-oxo-6-pyrrolidin-1-ylsulfonyl-1H-quinoline-4-carboxamide.
| Compound Name | N-[3-(N-butylanilino)propyl]-2-oxo-6-pyrrolidin-1-ylsulfonyl-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 20967939 |
| Molecular Formula | C27H34N4O4S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | N-[3-(N-butylanilino)propyl]-2-oxo-6-pyrrolidin-1-ylsulfonyl-1H-quinoline-4-carboxamide |
| SMILES | CCCCN(CCCNC(=O)c1cc(=O)[nH]c2ccc(S(=O)(=O)N3CCCC3)cc12)c1ccccc1 |
| InChI | InChI=1S/C27H34N4O4S/c1-2-3-15-30(21-10-5-4-6-11-21)16-9-14-28-27(33)24-20-26(32)29-25-13-12-22(19-23(24)25)36(34,35)31-17-7-8-18-31/h4-6,10-13,19-20H,2-3,7-9,14-18H2,1H3,(H,28,33)(H,29,32) |
| InChIKey | LOYKAPWUYRAOSO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|