C30H40N4O4S — CID 129448141
N-[3-[benzyl(butyl)amino]propyl]-6-[(2R)-2-methylpiperidin-1-yl]sulfonyl-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 129448141) has the molecular formula C30H40N4O4S and a molecular weight of 552.74 g/mol. Its IUPAC name is N-[3-[benzyl(butyl)amino]propyl]-6-[(2R)-2-methylpiperidin-1-yl]sulfonyl-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[3-[benzyl(butyl)amino]propyl]-6-[(2R)-2-methylpiperidin-1-yl]sulfonyl-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 129448141 |
| Molecular Formula | C30H40N4O4S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | N-[3-[benzyl(butyl)amino]propyl]-6-[(2R)-2-methylpiperidin-1-yl]sulfonyl-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CCCCN(CCCNC(=O)c1cc(=O)[nH]c2ccc(S(=O)(=O)N3CCCC[C@H]3C)cc12)Cc1ccccc1 |
| InChI | InChI=1S/C30H40N4O4S/c1-3-4-17-33(22-24-12-6-5-7-13-24)18-10-16-31-30(36)27-21-29(35)32-28-15-14-25(20-26(27)28)39(37,38)34-19-9-8-11-23(34)2/h5-7,12-15,20-21,23H,3-4,8-11,16-19,22H2,1-2H3,(H,31,36)(H,32,35)/t23-/m1/s1 |
| InChIKey | MQYCNGIOVPQSAK-HSZRJFAPSA-N |
| XLogP | 4.51 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|