C16H19N3O4S — CID 118553851
6-(2-methylpiperidin-1-yl)sulfonyl-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 118553851) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is 6-(2-methylpiperidin-1-yl)sulfonyl-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | 6-(2-methylpiperidin-1-yl)sulfonyl-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 118553851 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 6-(2-methylpiperidin-1-yl)sulfonyl-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc2[nH]c(=O)cc(C(N)=O)c2c1 |
| InChI | InChI=1S/C16H19N3O4S/c1-10-4-2-3-7-19(10)24(22,23)11-5-6-14-12(8-11)13(16(17)21)9-15(20)18-14/h5-6,8-10H,2-4,7H2,1H3,(H2,17,21)(H,18,20) |
| InChIKey | BCMUNTQJKGMBCK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |