C24H33N3O4S — CID 5323312
6-(2-ethylpiperidin-1-yl)sulfonyl-N-(2-methylcyclohexyl)-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 5323312) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is 6-(2-ethylpiperidin-1-yl)sulfonyl-N-(2-methylcyclohexyl)-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | 6-(2-ethylpiperidin-1-yl)sulfonyl-N-(2-methylcyclohexyl)-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 5323312 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 6-(2-ethylpiperidin-1-yl)sulfonyl-N-(2-methylcyclohexyl)-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CCC1CCCCN1S(=O)(=O)c1ccc2[nH]c(=O)cc(C(=O)NC3CCCCC3C)c2c1 |
| InChI | InChI=1S/C24H33N3O4S/c1-3-17-9-6-7-13-27(17)32(30,31)18-11-12-22-19(14-18)20(15-23(28)25-22)24(29)26-21-10-5-4-8-16(21)2/h11-12,14-17,21H,3-10,13H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | LTPWVPNXUUQRSF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |