C16H24Cl2N2O3S — CID 78796282
N-butyl-2,4-dichloro-N-methyl-5-(2-methylpropylsulfamoyl)benzamide (PubChem CID 78796282) has the molecular formula C16H24Cl2N2O3S and a molecular weight of 395.35 g/mol. Its IUPAC name is N-butyl-2,4-dichloro-N-methyl-5-(2-methylpropylsulfamoyl)benzamide.
| Compound Name | N-butyl-2,4-dichloro-N-methyl-5-(2-methylpropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 78796282 |
| Molecular Formula | C16H24Cl2N2O3S |
| Molecular Weight | 395.35 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | N-butyl-2,4-dichloro-N-methyl-5-(2-methylpropylsulfamoyl)benzamide |
| SMILES | CCCCN(C)C(=O)c1cc(S(=O)(=O)NCC(C)C)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H24Cl2N2O3S/c1-5-6-7-20(4)16(21)12-8-15(14(18)9-13(12)17)24(22,23)19-10-11(2)3/h8-9,11,19H,5-7,10H2,1-4H3 |
| InChIKey | AGEMHHKRVZWRSJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |