C19H21Cl2FN2O3S — CID 78816219
2,4-dichloro-N-[2-(3-fluorophenyl)ethyl]-5-(2-methylpropylsulfamoyl)benzamide (PubChem CID 78816219) has the molecular formula C19H21Cl2FN2O3S and a molecular weight of 447.36 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(3-fluorophenyl)ethyl]-5-(2-methylpropylsulfamoyl)benzamide.
| Compound Name | 2,4-dichloro-N-[2-(3-fluorophenyl)ethyl]-5-(2-methylpropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 78816219 |
| Molecular Formula | C19H21Cl2FN2O3S |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | 2,4-dichloro-N-[2-(3-fluorophenyl)ethyl]-5-(2-methylpropylsulfamoyl)benzamide |
| SMILES | CC(C)CNS(=O)(=O)c1cc(C(=O)NCCc2cccc(F)c2)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H21Cl2FN2O3S/c1-12(2)11-24-28(26,27)18-9-15(16(20)10-17(18)21)19(25)23-7-6-13-4-3-5-14(22)8-13/h3-5,8-10,12,24H,6-7,11H2,1-2H3,(H,23,25) |
| InChIKey | QKENSPLDCGOVSW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |