C17H12Cl2F3NO2S — CID 121124008
2,4-dichloro-5-methyl-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide (PubChem CID 121124008) has the molecular formula C17H12Cl2F3NO2S and a molecular weight of 422.26 g/mol. Its IUPAC name is 2,4-dichloro-5-methyl-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide.
| Compound Name | 2,4-dichloro-5-methyl-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121124008 |
| Molecular Formula | C17H12Cl2F3NO2S |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | 2,4-dichloro-5-methyl-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC#Cc2ccccc2C(F)(F)F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H12Cl2F3NO2S/c1-11-9-16(15(19)10-14(11)18)26(24,25)23-8-4-6-12-5-2-3-7-13(12)17(20,21)22/h2-3,5,7,9-10,23H,8H2,1H3 |
| InChIKey | NAOHYODESBKOSA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|