C17H11ClF3NO — CID 90550757
4-chloro-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide (PubChem CID 90550757) has the molecular formula C17H11ClF3NO and a molecular weight of 337.73 g/mol. Its IUPAC name is 4-chloro-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide.
| Compound Name | 4-chloro-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
|---|---|
| PubChem CID | 90550757 |
| Molecular Formula | C17H11ClF3NO |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 4-chloro-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
| SMILES | O=C(NCC#Cc1ccccc1C(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11ClF3NO/c18-14-9-7-13(8-10-14)16(23)22-11-3-5-12-4-1-2-6-15(12)17(19,20)21/h1-2,4,6-10H,11H2,(H,22,23) |
| InChIKey | IPHLABJSJSOOKI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|