C18H11F6NO2 — CID 121123998
4-(trifluoromethoxy)-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide (PubChem CID 121123998) has the molecular formula C18H11F6NO2 and a molecular weight of 387.28 g/mol. Its IUPAC name is 4-(trifluoromethoxy)-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide.
| Compound Name | 4-(trifluoromethoxy)-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
|---|---|
| PubChem CID | 121123998 |
| Molecular Formula | C18H11F6NO2 |
| Molecular Weight | 387.28 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 4-(trifluoromethoxy)-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]benzamide |
| SMILES | O=C(NCC#Cc1ccccc1C(F)(F)F)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H11F6NO2/c19-17(20,21)15-6-2-1-4-12(15)5-3-11-25-16(26)13-7-9-14(10-8-13)27-18(22,23)24/h1-2,4,6-10H,11H2,(H,25,26) |
| InChIKey | KIJGWXJODOSGCG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|