C16H10BrF3N2O — CID 90550702
5-bromo-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]pyridine-3-carboxamide (PubChem CID 90550702) has the molecular formula C16H10BrF3N2O and a molecular weight of 383.17 g/mol. Its IUPAC name is 5-bromo-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90550702 |
| Molecular Formula | C16H10BrF3N2O |
| Molecular Weight | 383.17 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 5-bromo-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC#Cc1ccccc1C(F)(F)F)c1cncc(Br)c1 |
| InChI | InChI=1S/C16H10BrF3N2O/c17-13-8-12(9-21-10-13)15(23)22-7-3-5-11-4-1-2-6-14(11)16(18,19)20/h1-2,4,6,8-10H,7H2,(H,22,23) |
| InChIKey | JGNFLLULABRDBY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.17 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|