C15H14F3NO — CID 90550872
N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]cyclobutanecarboxamide (PubChem CID 90550872) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 90550872 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]cyclobutanecarboxamide |
| SMILES | O=C(NCC#Cc1ccccc1C(F)(F)F)C1CCC1 |
| InChI | InChI=1S/C15H14F3NO/c16-15(17,18)13-9-2-1-5-11(13)8-4-10-19-14(20)12-6-3-7-12/h1-2,5,9,12H,3,6-7,10H2,(H,19,20) |
| InChIKey | QAOHITDWKDCFBC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|