C21H26F3NO — CID 121123985
4-butyl-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]cyclohexane-1-carboxamide (PubChem CID 121123985) has the molecular formula C21H26F3NO and a molecular weight of 365.44 g/mol. Its IUPAC name is 4-butyl-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]cyclohexane-1-carboxamide.
| Compound Name | 4-butyl-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 121123985 |
| Molecular Formula | C21H26F3NO |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 4-butyl-N-[3-[2-(trifluoromethyl)phenyl]prop-2-ynyl]cyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)NCC#Cc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H26F3NO/c1-2-3-7-16-11-13-18(14-12-16)20(26)25-15-6-9-17-8-4-5-10-19(17)21(22,23)24/h4-5,8,10,16,18H,2-3,7,11-15H2,1H3,(H,25,26) |
| InChIKey | XODKPCDAZVGIGY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|