C19H17BrN2O2 — CID 90576815
5-bromo-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]pyridine-3-carboxamide (PubChem CID 90576815) has the molecular formula C19H17BrN2O2 and a molecular weight of 385.26 g/mol. Its IUPAC name is 5-bromo-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90576815 |
| Molecular Formula | C19H17BrN2O2 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 5-bromo-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]pyridine-3-carboxamide |
| SMILES | C=CCc1ccccc1OCC#CCNC(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C19H17BrN2O2/c1-2-7-15-8-3-4-9-18(15)24-11-6-5-10-22-19(23)16-12-17(20)14-21-13-16/h2-4,8-9,12-14H,1,7,10-11H2,(H,22,23) |
| InChIKey | LUXYMOLGEHOFBN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|