C26H23NO3 — CID 121131581
4-phenoxy-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]benzamide (PubChem CID 121131581) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is 4-phenoxy-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]benzamide.
| Compound Name | 4-phenoxy-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]benzamide |
|---|---|
| PubChem CID | 121131581 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 4-phenoxy-N-[4-(2-prop-2-enylphenoxy)but-2-ynyl]benzamide |
| SMILES | C=CCc1ccccc1OCC#CCNC(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H23NO3/c1-2-10-21-11-6-7-14-25(21)29-20-9-8-19-27-26(28)22-15-17-24(18-16-22)30-23-12-4-3-5-13-23/h2-7,11-18H,1,10,19-20H2,(H,27,28) |
| InChIKey | SWNOVFDQFMOFPD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|